C30H38N6O5S — CID 169257609
2-[4-[4-[[4-(4-aminophenyl)sulfinylpiperazin-1-yl]methyl]piperidin-1-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 169257609) has the molecular formula C30H38N6O5S and a molecular weight of 594.74 g/mol. Its IUPAC name is 2-[4-[4-[[4-(4-aminophenyl)sulfinylpiperazin-1-yl]methyl]piperidin-1-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[4-[4-[[4-(4-aminophenyl)sulfinylpiperazin-1-yl]methyl]piperidin-1-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 169257609 |
| Molecular Formula | C30H38N6O5S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | 2-[4-[4-[[4-(4-aminophenyl)sulfinylpiperazin-1-yl]methyl]piperidin-1-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1C(=O)c2cccc(N3CCC(CN4CCN(S(=O)c5ccc(N)cc5)CC4)CC3)c2C1=O |
| InChI | InChI=1S/C30H38N6O5S/c1-32-28(38)26(6-3-19-37)36-29(39)24-4-2-5-25(27(24)30(36)40)34-13-11-21(12-14-34)20-33-15-17-35(18-16-33)42(41)23-9-7-22(31)8-10-23/h2,4-5,7-10,19,21,26H,3,6,11-18,20,31H2,1H3,(H,32,38) |
| InChIKey | IUEOXXZISOWDOA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|