C22H24FN5O3 — CID 169299879
7-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-6-hydroxychromen-4-one (PubChem CID 169299879) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 7-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-6-hydroxychromen-4-one.
| Compound Name | 7-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-6-hydroxychromen-4-one |
|---|---|
| PubChem CID | 169299879 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 7-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-6-hydroxychromen-4-one |
| SMILES | CN(c1cnc(-c2cc3occc(=O)c3cc2O)nn1)[C@H]1C[C@]2(C)CC[C@@](C)(N2)[C@H]1F |
| InChI | InChI=1S/C22H24FN5O3/c1-21-5-6-22(2,27-21)19(23)14(10-21)28(3)18-11-24-20(26-25-18)13-9-17-12(8-16(13)30)15(29)4-7-31-17/h4,7-9,11,14,19,27,30H,5-6,10H2,1-3H3/t14-,19-,21-,22+/m0/s1 |
| InChIKey | NVEGEAPDCMEUQL-JASAOFIISA-N |
| XLogP | 2.80 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |