C14H17BrN4O2 — CID 169324859
5-azido-4-bromo-1,1,3,3,6-pentamethyl-7-nitro-2H-indene (PubChem CID 169324859) has the molecular formula C14H17BrN4O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is 5-azido-4-bromo-1,1,3,3,6-pentamethyl-7-nitro-2H-indene.
| Compound Name | 5-azido-4-bromo-1,1,3,3,6-pentamethyl-7-nitro-2H-indene |
|---|---|
| PubChem CID | 169324859 |
| Molecular Formula | C14H17BrN4O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 5-azido-4-bromo-1,1,3,3,6-pentamethyl-7-nitro-2H-indene |
| SMILES | Cc1c(N=[N+]=[N-])c(Br)c2c(c1[N+](=O)[O-])C(C)(C)CC2(C)C |
| InChI | InChI=1S/C14H17BrN4O2/c1-7-11(17-18-16)10(15)8-9(12(7)19(20)21)14(4,5)6-13(8,2)3/h6H2,1-5H3 |
| InChIKey | CFECLHAMEHWGOO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|