C22H22NO4S3+ — CID 16958409
3-[5-methoxy-2-[(E)-2-(2-methylphenyl)ethenyl]thieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 16958409) has the molecular formula C22H22NO4S3+ and a molecular weight of 460.62 g/mol. Its IUPAC name is 3-[5-methoxy-2-[(E)-2-(2-methylphenyl)ethenyl]thieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-methoxy-2-[(E)-2-(2-methylphenyl)ethenyl]thieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 16958409 |
| Molecular Formula | C22H22NO4S3+ |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 3-[5-methoxy-2-[(E)-2-(2-methylphenyl)ethenyl]thieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | COc1cc2sc(/C=C/c3ccccc3C)[n+](CCCS(=O)(=O)O)c2c2sccc12 |
| InChI | InChI=1S/C22H21NO4S3/c1-15-6-3-4-7-16(15)8-9-20-23(11-5-13-30(24,25)26)21-19(29-20)14-18(27-2)17-10-12-28-22(17)21/h3-4,6-10,12,14H,5,11,13H2,1-2H3/p+1/b9-8+ |
| InChIKey | XLBBMPCYULANIE-CMDGGOBGSA-O |
| XLogP | 5.17 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|