C21H18F2NO4S3+ — CID 27111247
3-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 27111247) has the molecular formula C21H18F2NO4S3+ and a molecular weight of 482.58 g/mol. Its IUPAC name is 3-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 27111247 |
| Molecular Formula | C21H18F2NO4S3+ |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 3-[2-[(E)-2-(3,4-difluorophenyl)ethenyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | COc1cc2sc(/C=C/c3ccc(F)c(F)c3)[n+](CCCS(=O)(=O)O)c2c2sccc12 |
| InChI | InChI=1S/C21H17F2NO4S3/c1-28-17-12-18-20(21-14(17)7-9-29-21)24(8-2-10-31(25,26)27)19(30-18)6-4-13-3-5-15(22)16(23)11-13/h3-7,9,11-12H,2,8,10H2,1H3/p+1/b6-4+ |
| InChIKey | RRFJYALWARDCDE-GQCTYLIASA-O |
| XLogP | 5.14 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|