C29H42F9NO4 — CID 170078519
[4-methyl-4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxymethyl)-5-(2,4,4-trimethylhexan-2-yloxy)pentan-2-yl] 4-aminobenzoate (PubChem CID 170078519) has the molecular formula C29H42F9NO4 and a molecular weight of 639.64 g/mol. Its IUPAC name is [4-methyl-4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxymethyl)-5-(2,4,4-trimethylhexan-2-yloxy)pentan-2-yl] 4-aminobenzoate.
| Compound Name | [4-methyl-4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxymethyl)-5-(2,4,4-trimethylhexan-2-yloxy)pentan-2-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 170078519 |
| Molecular Formula | C29H42F9NO4 |
| Molecular Weight | 639.64 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | [4-methyl-4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxymethyl)-5-(2,4,4-trimethylhexan-2-yloxy)pentan-2-yl] 4-aminobenzoate |
| SMILES | CCC(C)(C)CC(C)(C)OCC(C)(COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(C)OC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C29H42F9NO4/c1-8-23(3,4)16-24(5,6)42-18-25(7,15-19(2)43-22(40)20-9-11-21(39)12-10-20)17-41-14-13-26(30,31)27(32,33)28(34,35)29(36,37)38/h9-12,19H,8,13-18,39H2,1-7H3 |
| InChIKey | QRRVEAZMQHSMRU-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.64 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|