C16H15FN2O4S2 — CID 170081911
3-[5-fluoro-2-oxo-7-[1-(thiiran-2-ylsulfanyl)ethyl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 170081911) has the molecular formula C16H15FN2O4S2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-[5-fluoro-2-oxo-7-[1-(thiiran-2-ylsulfanyl)ethyl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-2-oxo-7-[1-(thiiran-2-ylsulfanyl)ethyl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170081911 |
| Molecular Formula | C16H15FN2O4S2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-[5-fluoro-2-oxo-7-[1-(thiiran-2-ylsulfanyl)ethyl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | CC(SC1CS1)c1cc(F)cc2c1oc(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H15FN2O4S2/c1-7(25-13-6-24-13)9-4-8(17)5-11-14(9)23-16(22)19(11)10-2-3-12(20)18-15(10)21/h4-5,7,10,13H,2-3,6H2,1H3,(H,18,20,21) |
| InChIKey | DLPJGKRWXSETPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|