C20H20N4O — CID 170106175
5-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-pyridinyl]-2-oxa-5-azabicyclo[2.2.0]hexane (PubChem CID 170106175) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 5-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-pyridinyl]-2-oxa-5-azabicyclo[2.2.0]hexane.
| Compound Name | 5-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-pyridinyl]-2-oxa-5-azabicyclo[2.2.0]hexane |
|---|---|
| PubChem CID | 170106175 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-pyridinyl]-2-oxa-5-azabicyclo[2.2.0]hexane |
| SMILES | c1ccc2c3c([nH]c2c1)CN(c1ccc(N2CC4OCC42)nc1)CC3 |
| InChI | InChI=1S/C20H20N4O/c1-2-4-16-14(3-1)15-7-8-23(10-17(15)22-16)13-5-6-20(21-9-13)24-11-19-18(24)12-25-19/h1-6,9,18-19,22H,7-8,10-12H2 |
| InChIKey | XBAKIKQUZBCWGO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|