C21H22N4O — CID 146270792
4-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-pyridinyl]-4-azaspiro[2.3]hexan-6-ol (PubChem CID 146270792) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-pyridinyl]-4-azaspiro[2.3]hexan-6-ol.
| Compound Name | 4-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-pyridinyl]-4-azaspiro[2.3]hexan-6-ol |
|---|---|
| PubChem CID | 146270792 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-pyridinyl]-4-azaspiro[2.3]hexan-6-ol |
| SMILES | OC1CN(c2ccc(N3CCc4c([nH]c5ccccc45)C3)cn2)C12CC2 |
| InChI | InChI=1S/C21H22N4O/c26-19-13-25(21(19)8-9-21)20-6-5-14(11-22-20)24-10-7-16-15-3-1-2-4-17(15)23-18(16)12-24/h1-6,11,19,23,26H,7-10,12-13H2 |
| InChIKey | YEYUMUXMLHIXLW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|