C23H36N2O8S — CID 170210124
[(2R,3S,4S,5R,6R)-5-acetamido-2-ethyl-3-methyl-6-[2-[2-[(4-methylphenyl)sulfonylamino]ethoxy]ethoxy]oxan-4-yl] acetate (PubChem CID 170210124) has the molecular formula C23H36N2O8S and a molecular weight of 500.61 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-acetamido-2-ethyl-3-methyl-6-[2-[2-[(4-methylphenyl)sulfonylamino]ethoxy]ethoxy]oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-acetamido-2-ethyl-3-methyl-6-[2-[2-[(4-methylphenyl)sulfonylamino]ethoxy]ethoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 170210124 |
| Molecular Formula | C23H36N2O8S |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-acetamido-2-ethyl-3-methyl-6-[2-[2-[(4-methylphenyl)sulfonylamino]ethoxy]ethoxy]oxan-4-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](OCCOCCNS(=O)(=O)c2ccc(C)cc2)[C@H](NC(C)=O)[C@@H](OC(C)=O)[C@H]1C |
| InChI | InChI=1S/C23H36N2O8S/c1-6-20-16(3)22(32-18(5)27)21(25-17(4)26)23(33-20)31-14-13-30-12-11-24-34(28,29)19-9-7-15(2)8-10-19/h7-10,16,20-24H,6,11-14H2,1-5H3,(H,25,26)/t16-,20+,21+,22-,23+/m0/s1 |
| InChIKey | BDEQMXDFKLBFIT-QANUBGTFSA-N |
| XLogP | 1.51 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|