C22H36N4O8 — CID 170276997
(4-methyl-5-oxo-2H-furan-2-yl) N-[5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]pentyl]carbamate (PubChem CID 170276997) has the molecular formula C22H36N4O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is (4-methyl-5-oxo-2H-furan-2-yl) N-[5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]pentyl]carbamate.
| Compound Name | (4-methyl-5-oxo-2H-furan-2-yl) N-[5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]pentyl]carbamate |
|---|---|
| PubChem CID | 170276997 |
| Molecular Formula | C22H36N4O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | (4-methyl-5-oxo-2H-furan-2-yl) N-[5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]pentyl]carbamate |
| SMILES | CC1=CC(OC(=O)NCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C22H36N4O8/c1-14-13-15(31-16(14)27)32-18(28)24-12-10-8-9-11-23-17(25-19(29)33-21(2,3)4)26-20(30)34-22(5,6)7/h13,15H,8-12H2,1-7H3,(H,24,28)(H2,23,25,26,29,30) |
| InChIKey | SGLHBWZMQPRTRD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|