C16H19F2NO3 — CID 170298859
2-[[(9,9-difluoro-1,5,6,9a-tetrahydrofluoren-3-yl)-hydroxymethyl]amino]ethane-1,1-diol (PubChem CID 170298859) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-[[(9,9-difluoro-1,5,6,9a-tetrahydrofluoren-3-yl)-hydroxymethyl]amino]ethane-1,1-diol.
| Compound Name | 2-[[(9,9-difluoro-1,5,6,9a-tetrahydrofluoren-3-yl)-hydroxymethyl]amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 170298859 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[[(9,9-difluoro-1,5,6,9a-tetrahydrofluoren-3-yl)-hydroxymethyl]amino]ethane-1,1-diol |
| SMILES | OC(O)CNC(O)C1=CCC2C(=C1)C1=C(C=CCC1)C2(F)F |
| InChI | InChI=1S/C16H19F2NO3/c17-16(18)12-4-2-1-3-10(12)11-7-9(5-6-13(11)16)15(22)19-8-14(20)21/h2,4-5,7,13-15,19-22H,1,3,6,8H2 |
| InChIKey | CRENBKZKRUGRAE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|