C42H78O4S — CID 170363598
6-butyldec-2-ynyl 8-hydroxy-2,2,14,14-tetramethyl-15-nonylsulfanyl-15-oxopentadecanoate (PubChem CID 170363598) has the molecular formula C42H78O4S and a molecular weight of 679.15 g/mol. Its IUPAC name is 6-butyldec-2-ynyl 8-hydroxy-2,2,14,14-tetramethyl-15-nonylsulfanyl-15-oxopentadecanoate.
| Compound Name | 6-butyldec-2-ynyl 8-hydroxy-2,2,14,14-tetramethyl-15-nonylsulfanyl-15-oxopentadecanoate |
|---|---|
| PubChem CID | 170363598 |
| Molecular Formula | C42H78O4S |
| Molecular Weight | 679.15 g/mol |
| Exact Mass | 678.56 |
| IUPAC Name | 6-butyldec-2-ynyl 8-hydroxy-2,2,14,14-tetramethyl-15-nonylsulfanyl-15-oxopentadecanoate |
| SMILES | CCCCCCCCCSC(=O)C(C)(C)CCCCCC(O)CCCCCC(C)(C)C(=O)OCC#CCCC(CCCC)CCCC |
| InChI | InChI=1S/C42H78O4S/c1-8-11-14-15-16-17-27-36-47-40(45)42(6,7)34-25-19-23-32-38(43)31-22-18-24-33-41(4,5)39(44)46-35-26-20-21-30-37(28-12-9-2)29-13-10-3/h37-38,43H,8-19,21-25,27-36H2,1-7H3 |
| InChIKey | MBZQXXYKCQETCH-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.15 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|