C23H20FN3O5S — CID 170383703
2-(4-fluorophenyl)-N-hydroxy-2-[(4-hydroxyphenyl)sulfonyl-(1H-indol-5-ylmethyl)amino]acetamide (PubChem CID 170383703) has the molecular formula C23H20FN3O5S and a molecular weight of 469.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-hydroxy-2-[(4-hydroxyphenyl)sulfonyl-(1H-indol-5-ylmethyl)amino]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-hydroxy-2-[(4-hydroxyphenyl)sulfonyl-(1H-indol-5-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 170383703 |
| Molecular Formula | C23H20FN3O5S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-hydroxy-2-[(4-hydroxyphenyl)sulfonyl-(1H-indol-5-ylmethyl)amino]acetamide |
| SMILES | O=C(NO)C(c1ccc(F)cc1)N(Cc1ccc2[nH]ccc2c1)S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H20FN3O5S/c24-18-4-2-16(3-5-18)22(23(29)26-30)27(33(31,32)20-8-6-19(28)7-9-20)14-15-1-10-21-17(13-15)11-12-25-21/h1-13,22,25,28,30H,14H2,(H,26,29) |
| InChIKey | RIIZXJXMTKQBFG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|