C15H28O2 — CID 170539400
(Z)-6-hydroxy-2,7,8-trimethyl-3-propan-2-ylnon-5-en-4-one (PubChem CID 170539400) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (Z)-6-hydroxy-2,7,8-trimethyl-3-propan-2-ylnon-5-en-4-one.
| Compound Name | (Z)-6-hydroxy-2,7,8-trimethyl-3-propan-2-ylnon-5-en-4-one |
|---|---|
| PubChem CID | 170539400 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (Z)-6-hydroxy-2,7,8-trimethyl-3-propan-2-ylnon-5-en-4-one |
| SMILES | CC(C)C(C)/C(O)=C/C(=O)C(C(C)C)C(C)C |
| InChI | InChI=1S/C15H28O2/c1-9(2)12(7)13(16)8-14(17)15(10(3)4)11(5)6/h8-12,15-16H,1-7H3/b13-8- |
| InChIKey | PSGVWVKRDFQEHK-JYRVWZFOSA-N |
| XLogP | 4.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|