C12H16N2OS — CID 170568274
N-methylsulfanyl-N-[3-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]hydroxylamine (PubChem CID 170568274) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-methylsulfanyl-N-[3-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]hydroxylamine.
| Compound Name | N-methylsulfanyl-N-[3-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]hydroxylamine |
|---|---|
| PubChem CID | 170568274 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-methylsulfanyl-N-[3-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]hydroxylamine |
| SMILES | CSN(O)c1cccc(C2=CCNCC2)c1 |
| InChI | InChI=1S/C12H16N2OS/c1-16-14(15)12-4-2-3-11(9-12)10-5-7-13-8-6-10/h2-5,9,13,15H,6-8H2,1H3 |
| InChIKey | CLWCWPHIUNNATA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|