C22H32BNO8 — CID 170815512
3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (PubChem CID 170815512) has the molecular formula C22H32BNO8 and a molecular weight of 449.31 g/mol. Its IUPAC name is 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid.
| Compound Name | 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170815512 |
| Molecular Formula | C22H32BNO8 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| SMILES | COc1cc(C(CC(=O)O)B2OC(C)(C)C(C)(C)O2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H32BNO8/c1-21(2)22(3,4)32-23(31-21)16(13-20(26)27)15-6-7-17(18(12-15)28-5)30-14-19(25)24-8-10-29-11-9-24/h6-7,12,16H,8-11,13-14H2,1-5H3,(H,26,27) |
| InChIKey | NKGQDBPTYPXWAF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|