C24H36BNO8 — CID 170816706
ethyl 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816706) has the molecular formula C24H36BNO8 and a molecular weight of 477.36 g/mol. Its IUPAC name is ethyl 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816706 |
| Molecular Formula | C24H36BNO8 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | ethyl 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccc(OCC(=O)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C24H36BNO8/c1-7-31-22(28)15-18(25-33-23(2,3)24(4,5)34-25)17-8-9-19(20(14-17)29-6)32-16-21(27)26-10-12-30-13-11-26/h8-9,14,18H,7,10-13,15-16H2,1-6H3 |
| InChIKey | CQJHKDIDTUUSTJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|