C19H14ClN3O6S — CID 170840701
3-[(2-chloro-5-hydroxyphenyl)diazenyl]-4-hydroxy-6-(prop-2-enoylamino)naphthalene-2-sulfonic acid (PubChem CID 170840701) has the molecular formula C19H14ClN3O6S and a molecular weight of 447.86 g/mol. Its IUPAC name is 3-[(2-chloro-5-hydroxyphenyl)diazenyl]-4-hydroxy-6-(prop-2-enoylamino)naphthalene-2-sulfonic acid.
| Compound Name | 3-[(2-chloro-5-hydroxyphenyl)diazenyl]-4-hydroxy-6-(prop-2-enoylamino)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 170840701 |
| Molecular Formula | C19H14ClN3O6S |
| Molecular Weight | 447.86 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 3-[(2-chloro-5-hydroxyphenyl)diazenyl]-4-hydroxy-6-(prop-2-enoylamino)naphthalene-2-sulfonic acid |
| SMILES | C=CC(=O)Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3cc(O)ccc3Cl)c(O)c2c1 |
| InChI | InChI=1S/C19H14ClN3O6S/c1-2-17(25)21-11-4-3-10-7-16(30(27,28)29)18(19(26)13(10)8-11)23-22-15-9-12(24)5-6-14(15)20/h2-9,24,26H,1H2,(H,21,25)(H,27,28,29)/b23-22+ |
| InChIKey | WQEORTDPOXXZRY-GHVJWSGMSA-N |
| XLogP | 4.69 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|