C29H22N9NaO8S — CID 170846206
sodium 5-hydroxy-2-[(2-hydroxy-5-sulfophenyl)diazenyl]-4-[[4-[[4-[(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)diazenyl]phenyl]carbamoyl]phenyl]diazenyl]phenolate (PubChem CID 170846206) has the molecular formula C29H22N9NaO8S and a molecular weight of 679.61 g/mol. Its IUPAC name is sodium 5-hydroxy-2-[(2-hydroxy-5-sulfophenyl)diazenyl]-4-[[4-[[4-[(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)diazenyl]phenyl]carbamoyl]phenyl]diazenyl]phenolate.
| Compound Name | sodium 5-hydroxy-2-[(2-hydroxy-5-sulfophenyl)diazenyl]-4-[[4-[[4-[(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)diazenyl]phenyl]carbamoyl]phenyl]diazenyl]phenolate |
|---|---|
| PubChem CID | 170846206 |
| Molecular Formula | C29H22N9NaO8S |
| Molecular Weight | 679.61 g/mol |
| Exact Mass | 679.12 |
| IUPAC Name | sodium 5-hydroxy-2-[(2-hydroxy-5-sulfophenyl)diazenyl]-4-[[4-[[4-[(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)diazenyl]phenyl]carbamoyl]phenyl]diazenyl]phenolate |
| SMILES | CC1=NNC(=O)C1/N=N/c1ccc(NC(=O)c2ccc(/N=N/c3cc(/N=N/c4cc(S(=O)(=O)O)ccc4O)c([O-])cc3O)cc2)cc1.[Na+] |
| InChI | InChI=1S/C29H23N9O8S.Na/c1-15-27(29(43)38-31-15)37-33-19-8-6-17(7-9-19)30-28(42)16-2-4-18(5-3-16)32-34-22-13-23(26(41)14-25(22)40)36-35-21-12-20(47(44,45)46)10-11-24(21)39;/h2-14,27,39-41H,1H3,(H,30,42)(H,38,43)(H,44,45,46);/q;+1/p-1/b34-32+,36-35+,37-33+; |
| InChIKey | MZAKYBFUIJWZPG-MANGQQFLSA-M |
| XLogP | 2.46 |
| TPSA | 262.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.61 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|