C18H17CuN3O12S3 — CID 170853751
copper 2-[[3-oxido-1-oxo-1-[4-(2-sulfooxyethylsulfonyl)anilino]but-2-en-2-yl]diazenyl]-5-sulfophenolate (PubChem CID 170853751) has the molecular formula C18H17CuN3O12S3 and a molecular weight of 627.09 g/mol. Its IUPAC name is copper 2-[[3-oxido-1-oxo-1-[4-(2-sulfooxyethylsulfonyl)anilino]but-2-en-2-yl]diazenyl]-5-sulfophenolate.
| Compound Name | copper 2-[[3-oxido-1-oxo-1-[4-(2-sulfooxyethylsulfonyl)anilino]but-2-en-2-yl]diazenyl]-5-sulfophenolate |
|---|---|
| PubChem CID | 170853751 |
| Molecular Formula | C18H17CuN3O12S3 |
| Molecular Weight | 627.09 g/mol |
| Exact Mass | 625.93 |
| IUPAC Name | copper 2-[[3-oxido-1-oxo-1-[4-(2-sulfooxyethylsulfonyl)anilino]but-2-en-2-yl]diazenyl]-5-sulfophenolate |
| SMILES | CC([O-])=C(/N=N/c1ccc(S(=O)(=O)O)cc1[O-])C(=O)Nc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1.[Cu+2] |
| InChI | InChI=1S/C18H19N3O12S3.Cu/c1-11(22)17(21-20-15-7-6-14(10-16(15)23)35(27,28)29)18(24)19-12-2-4-13(5-3-12)34(25,26)9-8-33-36(30,31)32;/h2-7,10,22-23H,8-9H2,1H3,(H,19,24)(H,27,28,29)(H,30,31,32);/q;+2/p-2/b17-11?,21-20+; |
| InChIKey | AOKDAOSCEQWULP-RRYKCLPISA-L |
| XLogP | -0.09 |
| TPSA | 252.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.09 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|