C10H15NO3 — CID 170905240
(4R)-4-[(E)-2-methyl-3-oxohex-4-en-2-yl]-1,3-oxazolidin-2-one (PubChem CID 170905240) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (4R)-4-[(E)-2-methyl-3-oxohex-4-en-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(E)-2-methyl-3-oxohex-4-en-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 170905240 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (4R)-4-[(E)-2-methyl-3-oxohex-4-en-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C/C(=O)C(C)(C)[C@@H]1COC(=O)N1 |
| InChI | InChI=1S/C10H15NO3/c1-4-5-8(12)10(2,3)7-6-14-9(13)11-7/h4-5,7H,6H2,1-3H3,(H,11,13)/b5-4+/t7-/m0/s1 |
| InChIKey | ZXZMNYQHSYLENP-KPJROHGDSA-N |
| XLogP | 1.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|