C45H35IrN3-2 — CID 171043643
CID 171043643 (PubChem CID 171043643) has the molecular formula C45H35IrN3-2 and a molecular weight of 810.01 g/mol.
| Compound Name | CID 171043643 |
|---|---|
| PubChem CID | 171043643 |
| Molecular Formula | C45H35IrN3-2 |
| Molecular Weight | 810.01 g/mol |
| Exact Mass | 810.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)Cc1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1ccc2cc1c1nc3ccccc3n1c1cccc(c1)c1ccc3cccc2c3c1 |
| InChI | InChI=1S/C29H17N2.C16H18N.Ir/c1-2-13-28-27(12-1)30-29-23-9-3-8-22(16-23)25-11-5-6-19-14-15-21(18-26(19)25)20-7-4-10-24(17-20)31(28)29;1-16(2,3)11-13-9-10-15(17-12-13)14-7-5-4-6-8-14;/h1-8,10-18H;4-7,9-10,12H,11H2,1-3H3;/q2*-1; |
| InChIKey | QEIKHIYKFXHMEX-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.01 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|