C22H24ClN5O4 — CID 171107051
(1R,2R,3S,6S,7R)-2-(5-chloro-8-methyl-6-oxo-8,9-dihydro-7H-imidazo[4,5-h][1,6]naphthyridin-3-yl)-N,9,9-trimethyl-8,10-dioxatetracyclo[5.3.0.01,4.03,6]decane-6-carboxamide (PubChem CID 171107051) has the molecular formula C22H24ClN5O4 and a molecular weight of 457.92 g/mol. Its IUPAC name is (1R,2R,3S,6S,7R)-2-(5-chloro-8-methyl-6-oxo-8,9-dihydro-7H-imidazo[4,5-h][1,6]naphthyridin-3-yl)-N,9,9-trimethyl-8,10-dioxatetracyclo[5.3.0.01,4.03,6]decane-6-carboxamide.
| Compound Name | (1R,2R,3S,6S,7R)-2-(5-chloro-8-methyl-6-oxo-8,9-dihydro-7H-imidazo[4,5-h][1,6]naphthyridin-3-yl)-N,9,9-trimethyl-8,10-dioxatetracyclo[5.3.0.01,4.03,6]decane-6-carboxamide |
|---|---|
| PubChem CID | 171107051 |
| Molecular Formula | C22H24ClN5O4 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (1R,2R,3S,6S,7R)-2-(5-chloro-8-methyl-6-oxo-8,9-dihydro-7H-imidazo[4,5-h][1,6]naphthyridin-3-yl)-N,9,9-trimethyl-8,10-dioxatetracyclo[5.3.0.01,4.03,6]decane-6-carboxamide |
| SMILES | CNC(=O)[C@@]12CC3[C@@H]1[C@@H](n1cnc4c5c(c(Cl)nc41)C(=O)CC(C)N5)[C@]31OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C22H24ClN5O4/c1-8-5-10(29)11-13(26-8)14-17(27-16(11)23)28(7-25-14)15-12-9-6-21(12,19(30)24-4)18-22(9,15)32-20(2,3)31-18/h7-9,12,15,18,26H,5-6H2,1-4H3,(H,24,30)/t8?,9?,12-,15-,18-,21+,22-/m1/s1 |
| InChIKey | JORRBFCDWLYHJS-SJIKYZLWSA-N |
| XLogP | 2.30 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|