C20H20ClF3N2OS — CID 17132496
3-[3-chloro-2-(trifluoromethyl)phenyl]-1-(cyclohex-3-en-1-ylmethyl)-1-(furan-2-ylmethyl)thiourea (PubChem CID 17132496) has the molecular formula C20H20ClF3N2OS and a molecular weight of 428.91 g/mol. Its IUPAC name is 3-[3-chloro-2-(trifluoromethyl)phenyl]-1-(cyclohex-3-en-1-ylmethyl)-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 3-[3-chloro-2-(trifluoromethyl)phenyl]-1-(cyclohex-3-en-1-ylmethyl)-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17132496 |
| Molecular Formula | C20H20ClF3N2OS |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 3-[3-chloro-2-(trifluoromethyl)phenyl]-1-(cyclohex-3-en-1-ylmethyl)-1-(furan-2-ylmethyl)thiourea |
| SMILES | FC(F)(F)c1c(Cl)cccc1NC(=S)N(Cc1ccco1)CC1CC=CCC1 |
| InChI | InChI=1S/C20H20ClF3N2OS/c21-16-9-4-10-17(18(16)20(22,23)24)25-19(28)26(13-15-8-5-11-27-15)12-14-6-2-1-3-7-14/h1-2,4-5,8-11,14H,3,6-7,12-13H2,(H,25,28) |
| InChIKey | PPEDQJNNFMGCLQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|