C16H15ClN4O3S — CID 171385880
2-chloro-4-(3-hydroxyphenyl)-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 171385880) has the molecular formula C16H15ClN4O3S and a molecular weight of 378.84 g/mol. Its IUPAC name is 2-chloro-4-(3-hydroxyphenyl)-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-4-(3-hydroxyphenyl)-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171385880 |
| Molecular Formula | C16H15ClN4O3S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-chloro-4-(3-hydroxyphenyl)-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCn1ccnn1)c1ccc(-c2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C16H15ClN4O3S/c17-15-11-13(12-2-1-3-14(22)10-12)4-5-16(15)25(23,24)19-7-9-21-8-6-18-20-21/h1-6,8,10-11,19,22H,7,9H2 |
| InChIKey | OQVBAESBQZCZQO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |