C43H54O17 — CID 171433011
[(2R,3R,4R,5S,6S)-3,4,5-tri(butanoyloxy)-6-[1,3-di(butanoyloxy)-6,7-dihydroxy-9-oxoxanthen-2-yl]oxan-2-yl]methyl butanoate (PubChem CID 171433011) has the molecular formula C43H54O17 and a molecular weight of 842.89 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-tri(butanoyloxy)-6-[1,3-di(butanoyloxy)-6,7-dihydroxy-9-oxoxanthen-2-yl]oxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-tri(butanoyloxy)-6-[1,3-di(butanoyloxy)-6,7-dihydroxy-9-oxoxanthen-2-yl]oxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 171433011 |
| Molecular Formula | C43H54O17 |
| Molecular Weight | 842.89 g/mol |
| Exact Mass | 842.34 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-tri(butanoyloxy)-6-[1,3-di(butanoyloxy)-6,7-dihydroxy-9-oxoxanthen-2-yl]oxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1O[C@@H](c2c(OC(=O)CCC)cc3oc4cc(O)c(O)cc4c(=O)c3c2OC(=O)CCC)[C@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C43H54O17/c1-7-13-30(46)53-22-29-39(57-32(48)15-9-3)42(59-34(50)17-11-5)43(60-35(51)18-12-6)41(56-29)37-28(55-31(47)14-8-2)21-27-36(40(37)58-33(49)16-10-4)38(52)23-19-24(44)25(45)20-26(23)54-27/h19-21,29,39,41-45H,7-18,22H2,1-6H3/t29-,39-,41+,42+,43+/m1/s1 |
| InChIKey | BIWRXVUTDHWTKV-SNTNISEBSA-N |
| XLogP | 6.69 |
| TPSA | 237.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.89 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|