C57H82O15 — CID 171433012
[(2R,3R,4R,5S,6S)-6-[6,7-dibutyl-9-oxo-1,3-di(pentanoyloxy)xanthen-2-yl]-3,4,5-tri(pentanoyloxy)oxan-2-yl]methyl pentanoate (PubChem CID 171433012) has the molecular formula C57H82O15 and a molecular weight of 1007.27 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-6-[6,7-dibutyl-9-oxo-1,3-di(pentanoyloxy)xanthen-2-yl]-3,4,5-tri(pentanoyloxy)oxan-2-yl]methyl pentanoate.
| Compound Name | [(2R,3R,4R,5S,6S)-6-[6,7-dibutyl-9-oxo-1,3-di(pentanoyloxy)xanthen-2-yl]-3,4,5-tri(pentanoyloxy)oxan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 171433012 |
| Molecular Formula | C57H82O15 |
| Molecular Weight | 1007.27 g/mol |
| Exact Mass | 1006.57 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-6-[6,7-dibutyl-9-oxo-1,3-di(pentanoyloxy)xanthen-2-yl]-3,4,5-tri(pentanoyloxy)oxan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@H]1O[C@@H](c2c(OC(=O)CCCC)cc3oc4cc(CCCC)c(CCCC)cc4c(=O)c3c2OC(=O)CCCC)[C@H](OC(=O)CCCC)[C@@H](OC(=O)CCCC)[C@@H]1OC(=O)CCCC |
| InChI | InChI=1S/C57H82O15/c1-9-17-25-37-33-39-40(34-38(37)26-18-10-2)66-41-35-42(67-45(59)28-20-12-4)51(54(50(41)52(39)64)70-47(61)30-22-14-6)55-57(72-49(63)32-24-16-8)56(71-48(62)31-23-15-7)53(69-46(60)29-21-13-5)43(68-55)36-65-44(58)27-19-11-3/h33-35,43,53,55-57H,9-32,36H2,1-8H3/t43-,53-,55+,56+,57+/m1/s1 |
| InChIKey | GDWDZUKWUGNIMW-OHVITCAKSA-N |
| XLogP | 12.30 |
| TPSA | 197.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.27 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|