C32H32O17 — CID 75204419
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(6,7-diacetyloxy-1-hydroxy-3-methoxy-9-oxoxanthen-2-yl)oxan-2-yl]methyl acetate (PubChem CID 75204419) has the molecular formula C32H32O17 and a molecular weight of 688.59 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(6,7-diacetyloxy-1-hydroxy-3-methoxy-9-oxoxanthen-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(6,7-diacetyloxy-1-hydroxy-3-methoxy-9-oxoxanthen-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 75204419 |
| Molecular Formula | C32H32O17 |
| Molecular Weight | 688.59 g/mol |
| Exact Mass | 688.16 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(6,7-diacetyloxy-1-hydroxy-3-methoxy-9-oxoxanthen-2-yl)oxan-2-yl]methyl acetate |
| SMILES | COc1cc2oc3cc(OC(C)=O)c(OC(C)=O)cc3c(=O)c2c(O)c1[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H32O17/c1-12(33)42-11-24-29(45-15(4)36)31(46-16(5)37)32(47-17(6)38)30(49-24)26-22(41-7)10-23-25(28(26)40)27(39)18-8-20(43-13(2)34)21(44-14(3)35)9-19(18)48-23/h8-10,24,29-32,40H,11H2,1-7H3/t24-,29-,30+,31+,32+/m1/s1 |
| InChIKey | HTKGTNRXMGBWSI-JKYLVEPJSA-N |
| XLogP | 2.31 |
| TPSA | 226.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.59 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|