C18H16Br4 — CID 171476722
2,7,9,9-tetrabromo-1-pentylfluorene (PubChem CID 171476722) has the molecular formula C18H16Br4 and a molecular weight of 551.94 g/mol. Its IUPAC name is 2,7,9,9-tetrabromo-1-pentylfluorene.
| Compound Name | 2,7,9,9-tetrabromo-1-pentylfluorene |
|---|---|
| PubChem CID | 171476722 |
| Molecular Formula | C18H16Br4 |
| Molecular Weight | 551.94 g/mol |
| Exact Mass | 547.80 |
| IUPAC Name | 2,7,9,9-tetrabromo-1-pentylfluorene |
| SMILES | CCCCCc1c(Br)ccc2c1C(Br)(Br)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C18H16Br4/c1-2-3-4-5-14-16(20)9-8-13-12-7-6-11(19)10-15(12)18(21,22)17(13)14/h6-10H,2-5H2,1H3 |
| InChIKey | ICRSTFCACGNPTM-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.94 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|