C34H49N3 — CID 171538702
2-methyl-N-(2-methylphenyl)propan-1-imine;3-(10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)-1,2-dihydroimidazole (PubChem CID 171538702) has the molecular formula C34H49N3 and a molecular weight of 499.79 g/mol. Its IUPAC name is 2-methyl-N-(2-methylphenyl)propan-1-imine;3-(10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)-1,2-dihydroimidazole.
| Compound Name | 2-methyl-N-(2-methylphenyl)propan-1-imine;3-(10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 171538702 |
| Molecular Formula | C34H49N3 |
| Molecular Weight | 499.79 g/mol |
| Exact Mass | 499.39 |
| IUPAC Name | 2-methyl-N-(2-methylphenyl)propan-1-imine;3-(10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)-1,2-dihydroimidazole |
| SMILES | CC1=CCC2C3CC=C4CC(N5C=CNC5)CCC4(C)C3CCC12C.Cc1ccccc1/N=C/C(C)C |
| InChI | InChI=1S/C23H34N2.C11H15N/c1-16-4-7-20-19-6-5-17-14-18(25-13-12-24-15-25)8-10-23(17,3)21(19)9-11-22(16,20)2;1-9(2)8-12-11-7-5-4-6-10(11)3/h4-5,12-13,18-21,24H,6-11,14-15H2,1-3H3;4-9H,1-3H3/b;12-8+ |
| InChIKey | ZWFDZEMOGWYNEY-AMEPUADKSA-N |
| XLogP | 8.56 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.79 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|