C22H24ClF2N5O2Si — CID 171630322
[13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-5-yl]methanol (PubChem CID 171630322) has the molecular formula C22H24ClF2N5O2Si and a molecular weight of 492.00 g/mol. Its IUPAC name is [13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-5-yl]methanol.
| Compound Name | [13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-5-yl]methanol |
|---|---|
| PubChem CID | 171630322 |
| Molecular Formula | C22H24ClF2N5O2Si |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-5-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1nc(CO)c2c1-c1cc(Cl)ncc1NC(c1c(F)cccc1F)=N2 |
| InChI | InChI=1S/C22H24ClF2N5O2Si/c1-33(2,3)8-7-32-12-30-21-13-9-18(23)26-10-16(13)27-22(28-20(21)17(11-31)29-30)19-14(24)5-4-6-15(19)25/h4-6,9-10,31H,7-8,11-12H2,1-3H3,(H,27,28) |
| InChIKey | UKKWMTWGSMJJJW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|