About 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene
2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene (PubChem CID 171659367) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene.
Molecular Properties
| Compound Name | 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene |
| PubChem CID | 171659367 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene |
| SMILES | C/C=C\N=N\C.CCCC(C)C |
| InChI | InChI=1S/C6H14.C4H8N2/c1-4-5-6(2)3;1-3-4-6-5-2/h6H,4-5H2,1-3H3;3-4H,1-2H3/b;4-3-,6-5+ |
| InChIKey | RTWNTCPMAXMGPK-YOTQJPDSSA-N |
| XLogP | 4.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene?
The IUPAC name of 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene (CID 171659367) is 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene.
What is the SMILES notation for 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene?
The canonical SMILES for 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene is C/C=C\N=N\C.CCCC(C)C.
What is the InChIKey of 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene?
The InChIKey is RTWNTCPMAXMGPK-YOTQJPDSSA-N. The full InChI is InChI=1S/C6H14.C4H8N2/c1-4-5-6(2)3;1-3-4-6-5-2/h6H,4-5H2,1-3H3;3-4H,1-2H3/b;4-3-,6-5+.
What are the key properties of 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene?
2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene has a molecular weight of 170.30 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane;methyl-[(Z)-prop-1-enyl]diazene is sourced from PubChem (CID 171659367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).