C8H12N6O3S — CID 171713921
N-[4-amino-2-(2-hydrazinyl-2-oxoethyl)sulfanyl-6-oxo-1H-pyrimidin-5-yl]acetamide (PubChem CID 171713921) has the molecular formula C8H12N6O3S and a molecular weight of 272.29 g/mol. Its IUPAC name is N-[4-amino-2-(2-hydrazinyl-2-oxoethyl)sulfanyl-6-oxo-1H-pyrimidin-5-yl]acetamide.
| Compound Name | N-[4-amino-2-(2-hydrazinyl-2-oxoethyl)sulfanyl-6-oxo-1H-pyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 171713921 |
| Molecular Formula | C8H12N6O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-[4-amino-2-(2-hydrazinyl-2-oxoethyl)sulfanyl-6-oxo-1H-pyrimidin-5-yl]acetamide |
| SMILES | CC(=O)Nc1c(N)nc(SCC(=O)NN)[nH]c1=O |
| InChI | InChI=1S/C8H12N6O3S/c1-3(15)11-5-6(9)12-8(13-7(5)17)18-2-4(16)14-10/h2,10H2,1H3,(H,11,15)(H,14,16)(H3,9,12,13,17) |
| InChIKey | MHZIENBKPXTTPY-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|