C30H48N4 — CID 171722549
N-[2-[[C-(1-adamantyl)-N-methylcarbonimidoyl]amino]cyclohexyl]-N'-methyladamantane-1-carboximidamide (PubChem CID 171722549) has the molecular formula C30H48N4 and a molecular weight of 464.74 g/mol. Its IUPAC name is N-[2-[[C-(1-adamantyl)-N-methylcarbonimidoyl]amino]cyclohexyl]-N'-methyladamantane-1-carboximidamide.
| Compound Name | N-[2-[[C-(1-adamantyl)-N-methylcarbonimidoyl]amino]cyclohexyl]-N'-methyladamantane-1-carboximidamide |
|---|---|
| PubChem CID | 171722549 |
| Molecular Formula | C30H48N4 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | N-[2-[[C-(1-adamantyl)-N-methylcarbonimidoyl]amino]cyclohexyl]-N'-methyladamantane-1-carboximidamide |
| SMILES | C/N=C(/NC1CCCCC1N/C(=N/C)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H48N4/c1-31-27(29-13-19-7-20(14-29)9-21(8-19)15-29)33-25-5-3-4-6-26(25)34-28(32-2)30-16-22-10-23(17-30)12-24(11-22)18-30/h19-26H,3-18H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | DCZSTFBCHRNNTH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|