C43H74N2O5 — CID 171774568
1-O-butyl 3-O-[2-(3,5-diethyl-4-hydroxyphenyl)-2-ethylbutyl] 2,2-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)propanedioate (PubChem CID 171774568) has the molecular formula C43H74N2O5 and a molecular weight of 699.07 g/mol. Its IUPAC name is 1-O-butyl 3-O-[2-(3,5-diethyl-4-hydroxyphenyl)-2-ethylbutyl] 2,2-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)propanedioate.
| Compound Name | 1-O-butyl 3-O-[2-(3,5-diethyl-4-hydroxyphenyl)-2-ethylbutyl] 2,2-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)propanedioate |
|---|---|
| PubChem CID | 171774568 |
| Molecular Formula | C43H74N2O5 |
| Molecular Weight | 699.07 g/mol |
| Exact Mass | 698.56 |
| IUPAC Name | 1-O-butyl 3-O-[2-(3,5-diethyl-4-hydroxyphenyl)-2-ethylbutyl] 2,2-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)propanedioate |
| SMILES | CCCCOC(=O)C(C(=O)OCC(CC)(CC)c1cc(CC)c(O)c(CC)c1)(C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C43H74N2O5/c1-16-21-22-49-36(47)43(33-25-38(6,7)44(14)39(8,9)26-33,34-27-40(10,11)45(15)41(12,13)28-34)37(48)50-29-42(19-4,20-5)32-23-30(17-2)35(46)31(18-3)24-32/h23-24,33-34,46H,16-22,25-29H2,1-15H3 |
| InChIKey | GJLHUCNFNOUIPM-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.07 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|