C17H11Cl2N3 — CID 171793783
N-(3,4-dichlorophenyl)-9H-pyrido[2,3-b]indol-6-amine (PubChem CID 171793783) has the molecular formula C17H11Cl2N3 and a molecular weight of 328.20 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-9H-pyrido[2,3-b]indol-6-amine.
| Compound Name | N-(3,4-dichlorophenyl)-9H-pyrido[2,3-b]indol-6-amine |
|---|---|
| PubChem CID | 171793783 |
| Molecular Formula | C17H11Cl2N3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-9H-pyrido[2,3-b]indol-6-amine |
| SMILES | Clc1ccc(Nc2ccc3[nH]c4ncccc4c3c2)cc1Cl |
| InChI | InChI=1S/C17H11Cl2N3/c18-14-5-3-11(9-15(14)19)21-10-4-6-16-13(8-10)12-2-1-7-20-17(12)22-16/h1-9,21H,(H,20,22) |
| InChIKey | HEZYTGQCEHILJJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |