C11H14N2O2S2 — CID 171874290
1-(2-amino-1,3-benzothiazol-4-yl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874290) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-(2-amino-1,3-benzothiazol-4-yl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(2-amino-1,3-benzothiazol-4-yl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874290 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1-(2-amino-1,3-benzothiazol-4-yl)-4-sulfanylbutane-1,2-diol |
| SMILES | Nc1nc2c(C(O)C(O)CCS)cccc2s1 |
| InChI | InChI=1S/C11H14N2O2S2/c12-11-13-9-6(2-1-3-8(9)17-11)10(15)7(14)4-5-16/h1-3,7,10,14-16H,4-5H2,(H2,12,13) |
| InChIKey | XAADPYNXMBYRIG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|