About 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene
3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene (PubChem CID 171951348) has the molecular formula C9H11NS2
and a molecular weight of 197.33 g/mol. Its IUPAC name is 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene.
Analyze 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene?
The IUPAC name of 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene (CID 171951348) is 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene.
What is the SMILES notation for 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene?
The canonical SMILES for 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene is c1nc2c(s1)C1CCCC(C2)S1.
What is the InChIKey of 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene?
The InChIKey is HJPONQVRVLXMHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS2/c1-2-6-4-7-9(11-5-10-7)8(3-1)12-6/h5-6,8H,1-4H2.
What are the key properties of 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene?
3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene has a molecular weight of 197.33 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,12-dithia-5-azatricyclo[6.3.1.02,6]dodeca-2(6),4-diene is sourced from PubChem (CID 171951348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).