C20H20BrN3OS — CID 17217819
1-(2-bromophenyl)-3-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]urea (PubChem CID 17217819) has the molecular formula C20H20BrN3OS and a molecular weight of 430.37 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 17217819 |
| Molecular Formula | C20H20BrN3OS |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-(2-bromophenyl)-3-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]urea |
| SMILES | CC(C)(C)c1ccc(-c2csc(NC(=O)Nc3ccccc3Br)n2)cc1 |
| InChI | InChI=1S/C20H20BrN3OS/c1-20(2,3)14-10-8-13(9-11-14)17-12-26-19(23-17)24-18(25)22-16-7-5-4-6-15(16)21/h4-12H,1-3H3,(H2,22,23,24,25) |
| InChIKey | OLJZCSBICXJEBC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |