C20H37N4O4P — CID 172525540
tert-butyl-[4-[4-(1-tert-butyltriazol-4-yl)butanoylamino]cyclohexyl]oxyphosphinic acid (PubChem CID 172525540) has the molecular formula C20H37N4O4P and a molecular weight of 428.51 g/mol. Its IUPAC name is tert-butyl-[4-[4-(1-tert-butyltriazol-4-yl)butanoylamino]cyclohexyl]oxyphosphinic acid.
| Compound Name | tert-butyl-[4-[4-(1-tert-butyltriazol-4-yl)butanoylamino]cyclohexyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 172525540 |
| Molecular Formula | C20H37N4O4P |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | tert-butyl-[4-[4-(1-tert-butyltriazol-4-yl)butanoylamino]cyclohexyl]oxyphosphinic acid |
| SMILES | CC(C)(C)n1cc(CCCC(=O)NC2CCC(OP(=O)(O)C(C)(C)C)CC2)nn1 |
| InChI | InChI=1S/C20H37N4O4P/c1-19(2,3)24-14-16(22-23-24)8-7-9-18(25)21-15-10-12-17(13-11-15)28-29(26,27)20(4,5)6/h14-15,17H,7-13H2,1-6H3,(H,21,25)(H,26,27) |
| InChIKey | JRCZQZLGWZIHSB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|