C9H12F4 — CID 172572003
(2E,4E)-1,3,4,7-tetrafluoro-2,5-dimethylhepta-2,4-diene (PubChem CID 172572003) has the molecular formula C9H12F4 and a molecular weight of 196.19 g/mol. Its IUPAC name is (2E,4E)-1,3,4,7-tetrafluoro-2,5-dimethylhepta-2,4-diene.
| Compound Name | (2E,4E)-1,3,4,7-tetrafluoro-2,5-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 172572003 |
| Molecular Formula | C9H12F4 |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2E,4E)-1,3,4,7-tetrafluoro-2,5-dimethylhepta-2,4-diene |
| SMILES | C/C(CF)=C(F)/C(F)=C(/C)CCF |
| InChI | InChI=1S/C9H12F4/c1-6(3-4-10)8(12)9(13)7(2)5-11/h3-5H2,1-2H3/b8-6+,9-7+ |
| InChIKey | AUNKHHXEGDNWOQ-CDJQDVQCSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|