C14H22BNO3S — CID 172644523
2-cyclobutyloxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (PubChem CID 172644523) has the molecular formula C14H22BNO3S and a molecular weight of 295.21 g/mol. Its IUPAC name is 2-cyclobutyloxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole.
| Compound Name | 2-cyclobutyloxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 172644523 |
| Molecular Formula | C14H22BNO3S |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-cyclobutyloxy-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| SMILES | Cc1nc(OC2CCC2)sc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H22BNO3S/c1-9-11(15-18-13(2,3)14(4,5)19-15)20-12(16-9)17-10-7-6-8-10/h10H,6-8H2,1-5H3 |
| InChIKey | UAHSKHUQBZPFSL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|