C17H40NO2+ — CID 172685114
N,N-dimethyldodecan-1-amine;3-hydroxypropyloxidanium (PubChem CID 172685114) has the molecular formula C17H40NO2+ and a molecular weight of 290.51 g/mol. Its IUPAC name is N,N-dimethyldodecan-1-amine;3-hydroxypropyloxidanium.
| Compound Name | N,N-dimethyldodecan-1-amine;3-hydroxypropyloxidanium |
|---|---|
| PubChem CID | 172685114 |
| Molecular Formula | C17H40NO2+ |
| Molecular Weight | 290.51 g/mol |
| Exact Mass | 290.31 |
| IUPAC Name | N,N-dimethyldodecan-1-amine;3-hydroxypropyloxidanium |
| SMILES | CCCCCCCCCCCCN(C)C.OCCC[OH2+] |
| InChI | InChI=1S/C14H31N.C3H8O2/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;4-2-1-3-5/h4-14H2,1-3H3;4-5H,1-3H2/p+1 |
| InChIKey | INDRISTWROQVRB-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 46.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|