About disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane
disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane (PubChem CID 172709320) has the molecular formula C10H13BNa2O3
and a molecular weight of 238.00 g/mol. Its IUPAC name is disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane.
Molecular Properties
| Compound Name | disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane |
| PubChem CID | 172709320 |
| Molecular Formula | C10H13BNa2O3 |
| Molecular Weight | 238.00 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane |
| SMILES | CCc1ccc(OB([O-])[O-])c(C)c1C.[Na+].[Na+] |
| InChI | InChI=1S/C10H13BO3.2Na/c1-4-9-5-6-10(14-11(12)13)8(3)7(9)2;;/h5-6H,4H2,1-3H3;;/q-2;2*+1 |
| InChIKey | FAKKNWMHUHTQRM-UHFFFAOYSA-N |
| XLogP | -6.04 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.00 |
| LogP ≤ 5 | -6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane?
The IUPAC name of disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane (CID 172709320) is disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane.
What is the SMILES notation for disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane?
The canonical SMILES for disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane is CCc1ccc(OB([O-])[O-])c(C)c1C.[Na+].[Na+].
What is the InChIKey of disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane?
The InChIKey is FAKKNWMHUHTQRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BO3.2Na/c1-4-9-5-6-10(14-11(12)13)8(3)7(9)2;;/h5-6H,4H2,1-3H3;;/q-2;2*+1.
What are the key properties of disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane?
disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane has a molecular weight of 238.00 g/mol, XLogP of -6.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane is sourced from PubChem (CID 172709320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).