C10H13BNa2O3 — CID 172709320
disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane (PubChem CID 172709320) has the molecular formula C10H13BNa2O3 and a molecular weight of 238.00 g/mol. Its IUPAC name is disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane.
| Compound Name | disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane |
|---|---|
| PubChem CID | 172709320 |
| Molecular Formula | C10H13BNa2O3 |
| Molecular Weight | 238.00 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | disodium;(4-ethyl-2,3-dimethylphenoxy)-dioxidoborane |
| SMILES | CCc1ccc(OB([O-])[O-])c(C)c1C.[Na+].[Na+] |
| InChI | InChI=1S/C10H13BO3.2Na/c1-4-9-5-6-10(14-11(12)13)8(3)7(9)2;;/h5-6H,4H2,1-3H3;;/q-2;2*+1 |
| InChIKey | FAKKNWMHUHTQRM-UHFFFAOYSA-N |
| XLogP | -6.04 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.00 |
| LogP ≤ 5 | -6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|