C32H39F3N2NaO3Si — CID 172739467
CID 172739467 (PubChem CID 172739467) has the molecular formula C32H39F3N2NaO3Si and a molecular weight of 607.75 g/mol.
| Compound Name | CID 172739467 |
|---|---|
| PubChem CID | 172739467 |
| Molecular Formula | C32H39F3N2NaO3Si |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | — |
| SMILES | CC1C(=O)N(C(CO)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1c1cccc(C(F)(F)F)c1.[Na] |
| InChI | InChI=1S/C32H39F3N2O3Si.Na/c1-24-30(39)37(20-19-36(24)26-13-11-12-25(22-26)32(33,34)35)27(23-38)18-21-40-41(31(2,3)4,28-14-7-5-8-15-28)29-16-9-6-10-17-29;/h5-17,22,24,27,38H,18-21,23H2,1-4H3; |
| InChIKey | IWXQTAYCZFFRDJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|