About CID 172739467
CID 172739467 (PubChem CID 172739467) has the molecular formula C32H39F3N2NaO3Si
and a molecular weight of 607.75 g/mol.
Molecular Properties
| Compound Name | CID 172739467 |
| PubChem CID | 172739467 |
| Molecular Formula | C32H39F3N2NaO3Si |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | — |
| SMILES | CC1C(=O)N(C(CO)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1c1cccc(C(F)(F)F)c1.[Na] |
| InChI | InChI=1S/C32H39F3N2O3Si.Na/c1-24-30(39)37(20-19-36(24)26-13-11-12-25(22-26)32(33,34)35)27(23-38)18-21-40-41(31(2,3)4,28-14-7-5-8-15-28)29-16-9-6-10-17-29;/h5-17,22,24,27,38H,18-21,23H2,1-4H3; |
| InChIKey | IWXQTAYCZFFRDJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 172739467 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172739467?
The IUPAC name of CID 172739467 (CID 172739467) is not available.
What is the SMILES notation for CID 172739467?
The canonical SMILES for CID 172739467 is CC1C(=O)N(C(CO)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1c1cccc(C(F)(F)F)c1.[Na].
What is the InChIKey of CID 172739467?
The InChIKey is IWXQTAYCZFFRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H39F3N2O3Si.Na/c1-24-30(39)37(20-19-36(24)26-13-11-12-25(22-26)32(33,34)35)27(23-38)18-21-40-41(31(2,3)4,28-14-7-5-8-15-28)29-16-9-6-10-17-29;/h5-17,22,24,27,38H,18-21,23H2,1-4H3;.
What are the key properties of CID 172739467?
CID 172739467 has a molecular weight of 607.75 g/mol, XLogP of 4.69, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172739467 is sourced from PubChem (CID 172739467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).