C20H19F3N2O4 — CID 172824015
2,2,2-trifluoro-N-(3-methylbutan-2-yl)-N-[2-(4-nitrobenzoyl)phenyl]acetamide (PubChem CID 172824015) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(3-methylbutan-2-yl)-N-[2-(4-nitrobenzoyl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-(3-methylbutan-2-yl)-N-[2-(4-nitrobenzoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 172824015 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2,2,2-trifluoro-N-(3-methylbutan-2-yl)-N-[2-(4-nitrobenzoyl)phenyl]acetamide |
| SMILES | CC(C)C(C)N(C(=O)C(F)(F)F)c1ccccc1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-12(2)13(3)24(19(27)20(21,22)23)17-7-5-4-6-16(17)18(26)14-8-10-15(11-9-14)25(28)29/h4-13H,1-3H3 |
| InChIKey | UPNUEHNHLVWGFW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|