C8H9N3O — CID 172956620
(3Z)-3-hydrazinylidene-1,2-dihydroindol-2-ol (PubChem CID 172956620) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is (3Z)-3-hydrazinylidene-1,2-dihydroindol-2-ol.
| Compound Name | (3Z)-3-hydrazinylidene-1,2-dihydroindol-2-ol |
|---|---|
| PubChem CID | 172956620 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (3Z)-3-hydrazinylidene-1,2-dihydroindol-2-ol |
| SMILES | N/N=C1/c2ccccc2NC1O |
| InChI | InChI=1S/C8H9N3O/c9-11-7-5-3-1-2-4-6(5)10-8(7)12/h1-4,8,10,12H,9H2/b11-7- |
| InChIKey | AYPPGBGRVSUMDA-XFFZJAGNSA-N |
| XLogP | 0.09 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|