C12H17NO2S — CID 173098531
2,2-dihydroxyspiro[1H-2-benzothiophene-3,4'-piperidine] (PubChem CID 173098531) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 2,2-dihydroxyspiro[1H-2-benzothiophene-3,4'-piperidine].
| Compound Name | 2,2-dihydroxyspiro[1H-2-benzothiophene-3,4'-piperidine] |
|---|---|
| PubChem CID | 173098531 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2,2-dihydroxyspiro[1H-2-benzothiophene-3,4'-piperidine] |
| SMILES | OS1(O)Cc2ccccc2C12CCNCC2 |
| InChI | InChI=1S/C12H17NO2S/c14-16(15)9-10-3-1-2-4-11(10)12(16)5-7-13-8-6-12/h1-4,13-15H,5-9H2 |
| InChIKey | CBUGBUTYVXSSNJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |