C14H17N — CID 176678047
2-methylidenespiro[1H-indene-3,4'-piperidine] (PubChem CID 176678047) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-methylidenespiro[1H-indene-3,4'-piperidine].
| Compound Name | 2-methylidenespiro[1H-indene-3,4'-piperidine] |
|---|---|
| PubChem CID | 176678047 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-methylidenespiro[1H-indene-3,4'-piperidine] |
| SMILES | C=C1Cc2ccccc2C12CCNCC2 |
| InChI | InChI=1S/C14H17N/c1-11-10-12-4-2-3-5-13(12)14(11)6-8-15-9-7-14/h2-5,15H,1,6-10H2 |
| InChIKey | MRCXPYVQIGXJLB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|